C8H10ClIN2O3S — CID 70390683
(6S)-7-amino-3-(iodomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;hydrochloride (PubChem CID 70390683) has the molecular formula C8H10ClIN2O3S and a molecular weight of 376.60 g/mol. Its IUPAC name is (6S)-7-amino-3-(iodomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;hydrochloride.
| Compound Name | (6S)-7-amino-3-(iodomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 70390683 |
| Molecular Formula | C8H10ClIN2O3S |
| Molecular Weight | 376.60 g/mol |
| Exact Mass | 375.91 |
| IUPAC Name | (6S)-7-amino-3-(iodomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;hydrochloride |
| SMILES | Cl.NC1C(=O)N2C(C(=O)O)=C(CI)CS[C@@H]12 |
| InChI | InChI=1S/C8H9IN2O3S.ClH/c9-1-3-2-15-7-4(10)6(12)11(7)5(3)8(13)14;/h4,7H,1-2,10H2,(H,13,14);1H/t4?,7-;/m0./s1 |
| InChIKey | TYIAJWDPHGEDDT-KNRDRBAASA-N |
| XLogP | 0.42 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.60 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|