C12H20N3OS+ — CID 154413257
(6R,7R)-7-amino-3-[(1-methylpyrrolidin-1-ium-1-yl)methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one (PubChem CID 154413257) has the molecular formula C12H20N3OS+ and a molecular weight of 254.38 g/mol. Its IUPAC name is (6R,7R)-7-amino-3-[(1-methylpyrrolidin-1-ium-1-yl)methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one.
| Compound Name | (6R,7R)-7-amino-3-[(1-methylpyrrolidin-1-ium-1-yl)methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one |
|---|---|
| PubChem CID | 154413257 |
| Molecular Formula | C12H20N3OS+ |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (6R,7R)-7-amino-3-[(1-methylpyrrolidin-1-ium-1-yl)methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one |
| SMILES | C[N+]1(CC2=CN3C(=O)[C@@H](N)[C@H]3SC2)CCCC1 |
| InChI | InChI=1S/C12H20N3OS/c1-15(4-2-3-5-15)7-9-6-14-11(16)10(13)12(14)17-8-9/h6,10,12H,2-5,7-8,13H2,1H3/q+1/t10-,12-/m1/s1 |
| InChIKey | OCKDZJGWUKPSBY-ZYHUDNBSSA-N |
| XLogP | 0.35 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|