C9H12BrNO2S — CID 57006659
(6S,7S)-3-(bromomethyl)-7-(methoxymethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one (PubChem CID 57006659) has the molecular formula C9H12BrNO2S and a molecular weight of 278.17 g/mol. Its IUPAC name is (6S,7S)-3-(bromomethyl)-7-(methoxymethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one.
| Compound Name | (6S,7S)-3-(bromomethyl)-7-(methoxymethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one |
|---|---|
| PubChem CID | 57006659 |
| Molecular Formula | C9H12BrNO2S |
| Molecular Weight | 278.17 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | (6S,7S)-3-(bromomethyl)-7-(methoxymethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one |
| SMILES | COC[C@H]1C(=O)N2C=C(CBr)CS[C@@H]12 |
| InChI | InChI=1S/C9H12BrNO2S/c1-13-4-7-8(12)11-3-6(2-10)5-14-9(7)11/h3,7,9H,2,4-5H2,1H3/t7-,9-/m0/s1 |
| InChIKey | IJJZMVSPFRLVQW-CBAPKCEASA-N |
| XLogP | 1.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.17 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|