C10H13BrN2O5S — CID 70636676
(6R)-7-amino-3-(2-bromoethoxycarbonyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 70636676) has the molecular formula C10H13BrN2O5S and a molecular weight of 353.19 g/mol. Its IUPAC name is (6R)-7-amino-3-(2-bromoethoxycarbonyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-amino-3-(2-bromoethoxycarbonyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 70636676 |
| Molecular Formula | C10H13BrN2O5S |
| Molecular Weight | 353.19 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | (6R)-7-amino-3-(2-bromoethoxycarbonyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | NC1C(=O)N2CC(C(=O)O)(C(=O)OCCBr)CS[C@H]12 |
| InChI | InChI=1S/C10H13BrN2O5S/c11-1-2-18-9(17)10(8(15)16)3-13-6(14)5(12)7(13)19-4-10/h5,7H,1-4,12H2,(H,15,16)/t5?,7-,10?/m1/s1 |
| InChIKey | GFZZLSRYBBRKPS-OJQMZVLSSA-N |
| XLogP | -0.76 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.19 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|