C23H24N2O3S — CID 70396610
benzhydryl (6R)-7-amino-8-oxo-3-prop-1-en-2-yl-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 70396610) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is benzhydryl (6R)-7-amino-8-oxo-3-prop-1-en-2-yl-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | benzhydryl (6R)-7-amino-8-oxo-3-prop-1-en-2-yl-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 70396610 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | benzhydryl (6R)-7-amino-8-oxo-3-prop-1-en-2-yl-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | C=C(C)C1(C(=O)OC(c2ccccc2)c2ccccc2)CS[C@@H]2C(N)C(=O)N2C1 |
| InChI | InChI=1S/C23H24N2O3S/c1-15(2)23(13-25-20(26)18(24)21(25)29-14-23)22(27)28-19(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,18-19,21H,1,13-14,24H2,2H3/t18?,21-,23?/m1/s1 |
| InChIKey | BBFGPXSWCOZKIV-JRSYVHTFSA-N |
| XLogP | 3.12 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|