C33H28N2O5S3 — CID 88843515
benzhydryl (6R)-7-[acetyl(thiophen-2-yl)amino]-8-oxo-3-phenylsulfanylcarbonyl-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 88843515) has the molecular formula C33H28N2O5S3 and a molecular weight of 628.80 g/mol. Its IUPAC name is benzhydryl (6R)-7-[acetyl(thiophen-2-yl)amino]-8-oxo-3-phenylsulfanylcarbonyl-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | benzhydryl (6R)-7-[acetyl(thiophen-2-yl)amino]-8-oxo-3-phenylsulfanylcarbonyl-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 88843515 |
| Molecular Formula | C33H28N2O5S3 |
| Molecular Weight | 628.80 g/mol |
| Exact Mass | 628.12 |
| IUPAC Name | benzhydryl (6R)-7-[acetyl(thiophen-2-yl)amino]-8-oxo-3-phenylsulfanylcarbonyl-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | CC(=O)N(c1cccs1)C1C(=O)N2CC(C(=O)OC(c3ccccc3)c3ccccc3)(C(=O)Sc3ccccc3)CS[C@H]12 |
| InChI | InChI=1S/C33H28N2O5S3/c1-22(36)35(26-18-11-19-41-26)27-29(37)34-20-33(21-42-30(27)34,32(39)43-25-16-9-4-10-17-25)31(38)40-28(23-12-5-2-6-13-23)24-14-7-3-8-15-24/h2-19,27-28,30H,20-21H2,1H3/t27?,30-,33?/m1/s1 |
| InChIKey | UAJBCECYJFUKAT-TXIALNMSSA-N |
| XLogP | 6.02 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.80 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|