C31H27F3N2O4S — CID 70350920
benzhydryl (6R)-7-(N-acetylanilino)-8-oxo-3-(3,3,3-trifluoroprop-1-enyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 70350920) has the molecular formula C31H27F3N2O4S and a molecular weight of 580.63 g/mol. Its IUPAC name is benzhydryl (6R)-7-(N-acetylanilino)-8-oxo-3-(3,3,3-trifluoroprop-1-enyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | benzhydryl (6R)-7-(N-acetylanilino)-8-oxo-3-(3,3,3-trifluoroprop-1-enyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 70350920 |
| Molecular Formula | C31H27F3N2O4S |
| Molecular Weight | 580.63 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | benzhydryl (6R)-7-(N-acetylanilino)-8-oxo-3-(3,3,3-trifluoroprop-1-enyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | CC(=O)N(c1ccccc1)C1C(=O)N2CC(C=CC(F)(F)F)(C(=O)OC(c3ccccc3)c3ccccc3)CS[C@H]12 |
| InChI | InChI=1S/C31H27F3N2O4S/c1-21(37)36(24-15-9-4-10-16-24)25-27(38)35-19-30(20-41-28(25)35,17-18-31(32,33)34)29(39)40-26(22-11-5-2-6-12-22)23-13-7-3-8-14-23/h2-18,25-26,28H,19-20H2,1H3/t25?,28-,30?/m1/s1 |
| InChIKey | LUUBJRBGDWSKPP-OTDMGWBDSA-N |
| XLogP | 5.76 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.63 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|