C31H32N4O6S2 — CID 70617230
benzhydryl (6R)-7-[acetyl(thiophen-2-yl)amino]-3-[[(2-ethoxy-2-oxoethyl)hydrazinylidene]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 70617230) has the molecular formula C31H32N4O6S2 and a molecular weight of 620.75 g/mol. Its IUPAC name is benzhydryl (6R)-7-[acetyl(thiophen-2-yl)amino]-3-[[(2-ethoxy-2-oxoethyl)hydrazinylidene]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | benzhydryl (6R)-7-[acetyl(thiophen-2-yl)amino]-3-[[(2-ethoxy-2-oxoethyl)hydrazinylidene]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 70617230 |
| Molecular Formula | C31H32N4O6S2 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.18 |
| IUPAC Name | benzhydryl (6R)-7-[acetyl(thiophen-2-yl)amino]-3-[[(2-ethoxy-2-oxoethyl)hydrazinylidene]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | CCOC(=O)CNN=CC1(C(=O)OC(c2ccccc2)c2ccccc2)CS[C@@H]2C(N(C(C)=O)c3cccs3)C(=O)N2C1 |
| InChI | InChI=1S/C31H32N4O6S2/c1-3-40-25(37)17-32-33-18-31(30(39)41-27(22-11-6-4-7-12-22)23-13-8-5-9-14-23)19-34-28(38)26(29(34)43-20-31)35(21(2)36)24-15-10-16-42-24/h4-16,18,26-27,29,32H,3,17,19-20H2,1-2H3/t26?,29-,31?/m1/s1 |
| InChIKey | FQZCKNBLIIONAJ-GJJFRKJYSA-N |
| XLogP | 3.84 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|