C29H24Cl2N2O4S2 — CID 88819023
benzhydryl (6R)-3-carbonochloridoyl-7-(4-chloro-N-ethanethioylanilino)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 88819023) has the molecular formula C29H24Cl2N2O4S2 and a molecular weight of 599.56 g/mol. Its IUPAC name is benzhydryl (6R)-3-carbonochloridoyl-7-(4-chloro-N-ethanethioylanilino)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | benzhydryl (6R)-3-carbonochloridoyl-7-(4-chloro-N-ethanethioylanilino)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 88819023 |
| Molecular Formula | C29H24Cl2N2O4S2 |
| Molecular Weight | 599.56 g/mol |
| Exact Mass | 598.06 |
| IUPAC Name | benzhydryl (6R)-3-carbonochloridoyl-7-(4-chloro-N-ethanethioylanilino)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | CC(=S)N(c1ccc(Cl)cc1)C1C(=O)N2CC(C(=O)Cl)(C(=O)OC(c3ccccc3)c3ccccc3)CS[C@H]12 |
| InChI | InChI=1S/C29H24Cl2N2O4S2/c1-18(38)33(22-14-12-21(30)13-15-22)23-25(34)32-16-29(27(31)35,17-39-26(23)32)28(36)37-24(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-15,23-24,26H,16-17H2,1H3/t23?,26-,29?/m1/s1 |
| InChIKey | CSSIPXYWULBSPP-NOQRGWLFSA-N |
| XLogP | 5.86 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.56 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|