C21H25ClN2O7S — CID 88723183
tert-butyl (6R)-7-[acetyloxy-(2-chloro-2-phenylacetyl)amino]-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 88723183) has the molecular formula C21H25ClN2O7S and a molecular weight of 484.96 g/mol. Its IUPAC name is tert-butyl (6R)-7-[acetyloxy-(2-chloro-2-phenylacetyl)amino]-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | tert-butyl (6R)-7-[acetyloxy-(2-chloro-2-phenylacetyl)amino]-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 88723183 |
| Molecular Formula | C21H25ClN2O7S |
| Molecular Weight | 484.96 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | tert-butyl (6R)-7-[acetyloxy-(2-chloro-2-phenylacetyl)amino]-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | CC(=O)ON(C(=O)C(Cl)c1ccccc1)C1C(=O)N2CC(O)(C(=O)OC(C)(C)C)CS[C@H]12 |
| InChI | InChI=1S/C21H25ClN2O7S/c1-12(25)31-24(16(26)14(22)13-8-6-5-7-9-13)15-17(27)23-10-21(29,11-32-18(15)23)19(28)30-20(2,3)4/h5-9,14-15,18,29H,10-11H2,1-4H3/t14?,15?,18-,21?/m1/s1 |
| InChIKey | RGXSLUKPFBMYCA-PARSUAIFSA-N |
| XLogP | 1.63 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.96 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|