C18H22N2O7S — CID 88715964
(6R)-7-[acetyl-(4-methoxyphenoxy)amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 88715964) has the molecular formula C18H22N2O7S and a molecular weight of 410.45 g/mol. Its IUPAC name is (6R)-7-[acetyl-(4-methoxyphenoxy)amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-[acetyl-(4-methoxyphenoxy)amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 88715964 |
| Molecular Formula | C18H22N2O7S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | (6R)-7-[acetyl-(4-methoxyphenoxy)amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | COCC1(C(=O)O)CS[C@@H]2C(N(Oc3ccc(OC)cc3)C(C)=O)C(=O)N2C1 |
| InChI | InChI=1S/C18H22N2O7S/c1-11(21)20(27-13-6-4-12(26-3)5-7-13)14-15(22)19-8-18(9-25-2,17(23)24)10-28-16(14)19/h4-7,14,16H,8-10H2,1-3H3,(H,23,24)/t14?,16-,18?/m1/s1 |
| InChIKey | UMAPJKFJUNCNHY-BFHRDPOASA-N |
| XLogP | 0.84 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|