C8H11BrN2O3S — CID 70357820
(6R)-7-amino-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 70357820) has the molecular formula C8H11BrN2O3S and a molecular weight of 295.16 g/mol. Its IUPAC name is (6R)-7-amino-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-amino-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 70357820 |
| Molecular Formula | C8H11BrN2O3S |
| Molecular Weight | 295.16 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | (6R)-7-amino-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | NC1C(=O)N2CC(CBr)(C(=O)O)CS[C@H]12 |
| InChI | InChI=1S/C8H11BrN2O3S/c9-1-8(7(13)14)2-11-5(12)4(10)6(11)15-3-8/h4,6H,1-3,10H2,(H,13,14)/t4?,6-,8?/m1/s1 |
| InChIKey | OFTIGPVIOZSGKW-UXNMLULZSA-N |
| XLogP | -0.31 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.16 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|