C7H10Cl2N2O3S — CID 70362259
(6R)-7-amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid;hydrochloride (PubChem CID 70362259) has the molecular formula C7H10Cl2N2O3S and a molecular weight of 273.14 g/mol. Its IUPAC name is (6R)-7-amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid;hydrochloride.
| Compound Name | (6R)-7-amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 70362259 |
| Molecular Formula | C7H10Cl2N2O3S |
| Molecular Weight | 273.14 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | (6R)-7-amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid;hydrochloride |
| SMILES | Cl.NC1C(=O)N2CC(Cl)(C(=O)O)CS[C@H]12 |
| InChI | InChI=1S/C7H9ClN2O3S.ClH/c8-7(6(12)13)1-10-4(11)3(9)5(10)14-2-7;/h3,5H,1-2,9H2,(H,12,13);1H/t3?,5-,7?;/m1./s1 |
| InChIKey | ASIFGGCZDRSZKB-PSGCEQDESA-N |
| XLogP | -0.29 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.14 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|