C15H14Cl2N2O7S2 — CID 88760529
(6R)-3-chloro-7-(3-chloro-N-(2-sulfoacetyl)anilino)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 88760529) has the molecular formula C15H14Cl2N2O7S2 and a molecular weight of 469.32 g/mol. Its IUPAC name is (6R)-3-chloro-7-(3-chloro-N-(2-sulfoacetyl)anilino)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-3-chloro-7-(3-chloro-N-(2-sulfoacetyl)anilino)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 88760529 |
| Molecular Formula | C15H14Cl2N2O7S2 |
| Molecular Weight | 469.32 g/mol |
| Exact Mass | 467.96 |
| IUPAC Name | (6R)-3-chloro-7-(3-chloro-N-(2-sulfoacetyl)anilino)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | O=C(CS(=O)(=O)O)N(c1cccc(Cl)c1)C1C(=O)N2CC(Cl)(C(=O)O)CS[C@H]12 |
| InChI | InChI=1S/C15H14Cl2N2O7S2/c16-8-2-1-3-9(4-8)19(10(20)5-28(24,25)26)11-12(21)18-6-15(17,14(22)23)7-27-13(11)18/h1-4,11,13H,5-7H2,(H,22,23)(H,24,25,26)/t11?,13-,15?/m1/s1 |
| InChIKey | FIXZMEMRALTUDX-GLWUULTISA-N |
| XLogP | 0.91 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|