C11H8ClNO4 — CID 70623192
2-[3-(3-chlorophenyl)-2,4-dioxoazetidin-1-yl]acetic acid (PubChem CID 70623192) has the molecular formula C11H8ClNO4 and a molecular weight of 253.64 g/mol. Its IUPAC name is 2-[3-(3-chlorophenyl)-2,4-dioxoazetidin-1-yl]acetic acid.
| Compound Name | 2-[3-(3-chlorophenyl)-2,4-dioxoazetidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 70623192 |
| Molecular Formula | C11H8ClNO4 |
| Molecular Weight | 253.64 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 2-[3-(3-chlorophenyl)-2,4-dioxoazetidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C(c2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C11H8ClNO4/c12-7-3-1-2-6(4-7)9-10(16)13(11(9)17)5-8(14)15/h1-4,9H,5H2,(H,14,15) |
| InChIKey | WIFZUCALJLBJKY-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.64 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|