C19H21ClO5 — CID 71739309
diethyl 4-(3-chlorophenyl)-2,6-dimethyl-4H-pyran-3,5-dicarboxylate (PubChem CID 71739309) has the molecular formula C19H21ClO5 and a molecular weight of 364.83 g/mol. Its IUPAC name is diethyl 4-(3-chlorophenyl)-2,6-dimethyl-4H-pyran-3,5-dicarboxylate.
| Compound Name | diethyl 4-(3-chlorophenyl)-2,6-dimethyl-4H-pyran-3,5-dicarboxylate |
|---|---|
| PubChem CID | 71739309 |
| Molecular Formula | C19H21ClO5 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | diethyl 4-(3-chlorophenyl)-2,6-dimethyl-4H-pyran-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(C)=C(C(=O)OCC)C1c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H21ClO5/c1-5-23-18(21)15-11(3)25-12(4)16(19(22)24-6-2)17(15)13-8-7-9-14(20)10-13/h7-10,17H,5-6H2,1-4H3 |
| InChIKey | QBSXQSHVLDXRAA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |