C22H21ClN2O4 — CID 8613933
ethyl (4S)-2-amino-4-(3-chlorophenyl)-6-methyl-5-(phenylcarbamoyl)-4H-pyran-3-carboxylate (PubChem CID 8613933) has the molecular formula C22H21ClN2O4 and a molecular weight of 412.87 g/mol. Its IUPAC name is ethyl (4S)-2-amino-4-(3-chlorophenyl)-6-methyl-5-(phenylcarbamoyl)-4H-pyran-3-carboxylate.
| Compound Name | ethyl (4S)-2-amino-4-(3-chlorophenyl)-6-methyl-5-(phenylcarbamoyl)-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 8613933 |
| Molecular Formula | C22H21ClN2O4 |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | ethyl (4S)-2-amino-4-(3-chlorophenyl)-6-methyl-5-(phenylcarbamoyl)-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(N)OC(C)=C(C(=O)Nc2ccccc2)[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H21ClN2O4/c1-3-28-22(27)19-18(14-8-7-9-15(23)12-14)17(13(2)29-20(19)24)21(26)25-16-10-5-4-6-11-16/h4-12,18H,3,24H2,1-2H3,(H,25,26)/t18-/m0/s1 |
| InChIKey | NBIYSNWQXPDJFI-SFHVURJKSA-N |
| XLogP | 4.10 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |