C18H17NO3 — CID 40554150
ethyl (4R)-2-amino-4-phenyl-4H-chromene-3-carboxylate (PubChem CID 40554150) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is ethyl (4R)-2-amino-4-phenyl-4H-chromene-3-carboxylate.
| Compound Name | ethyl (4R)-2-amino-4-phenyl-4H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 40554150 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | ethyl (4R)-2-amino-4-phenyl-4H-chromene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(N)Oc2ccccc2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H17NO3/c1-2-21-18(20)16-15(12-8-4-3-5-9-12)13-10-6-7-11-14(13)22-17(16)19/h3-11,15H,2,19H2,1H3/t15-/m1/s1 |
| InChIKey | PDVADOHUAUXDAY-OAHLLOKOSA-N |
| XLogP | 2.94 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |