C15H13N3O3 — CID 6923286
ethyl (4S)-2-amino-4-(dicyanomethyl)-4H-chromene-3-carboxylate (PubChem CID 6923286) has the molecular formula C15H13N3O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is ethyl (4S)-2-amino-4-(dicyanomethyl)-4H-chromene-3-carboxylate.
| Compound Name | ethyl (4S)-2-amino-4-(dicyanomethyl)-4H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 6923286 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | ethyl (4S)-2-amino-4-(dicyanomethyl)-4H-chromene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(N)Oc2ccccc2[C@@H]1C(C#N)C#N |
| InChI | InChI=1S/C15H13N3O3/c1-2-20-15(19)13-12(9(7-16)8-17)10-5-3-4-6-11(10)21-14(13)18/h3-6,9,12H,2,18H2,1H3/t12-/m0/s1 |
| InChIKey | PGZXQGHYGPTEEZ-LBPRGKRZSA-N |
| XLogP | 1.56 |
| TPSA | 109.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |