C22H18ClNO3 — CID 7039551
ethyl (1S)-3-amino-1-(2-chlorophenyl)-1H-benzo[f]chromene-2-carboxylate (PubChem CID 7039551) has the molecular formula C22H18ClNO3 and a molecular weight of 379.84 g/mol. Its IUPAC name is ethyl (1S)-3-amino-1-(2-chlorophenyl)-1H-benzo[f]chromene-2-carboxylate.
| Compound Name | ethyl (1S)-3-amino-1-(2-chlorophenyl)-1H-benzo[f]chromene-2-carboxylate |
|---|---|
| PubChem CID | 7039551 |
| Molecular Formula | C22H18ClNO3 |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | ethyl (1S)-3-amino-1-(2-chlorophenyl)-1H-benzo[f]chromene-2-carboxylate |
| SMILES | CCOC(=O)C1=C(N)Oc2ccc3ccccc3c2[C@@H]1c1ccccc1Cl |
| InChI | InChI=1S/C22H18ClNO3/c1-2-26-22(25)20-19(15-9-5-6-10-16(15)23)18-14-8-4-3-7-13(14)11-12-17(18)27-21(20)24/h3-12,19H,2,24H2,1H3/t19-/m0/s1 |
| InChIKey | ACLWBEWVFYECLS-IBGZPJMESA-N |
| XLogP | 4.75 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |