C19H13ClO — CID 132583807
1-(2-chlorophenyl)-2-methylidene-1H-benzo[e][1]benzofuran (PubChem CID 132583807) has the molecular formula C19H13ClO and a molecular weight of 292.76 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-2-methylidene-1H-benzo[e][1]benzofuran.
| Compound Name | 1-(2-chlorophenyl)-2-methylidene-1H-benzo[e][1]benzofuran |
|---|---|
| PubChem CID | 132583807 |
| Molecular Formula | C19H13ClO |
| Molecular Weight | 292.76 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 1-(2-chlorophenyl)-2-methylidene-1H-benzo[e][1]benzofuran |
| SMILES | C=C1Oc2ccc3ccccc3c2C1c1ccccc1Cl |
| InChI | InChI=1S/C19H13ClO/c1-12-18(15-8-4-5-9-16(15)20)19-14-7-3-2-6-13(14)10-11-17(19)21-12/h2-11,18H,1H2 |
| InChIKey | RCZMPKPOVVVRLC-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.76 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |