C26H19ClN2O2 — CID 139218106
1-(2-chlorophenyl)-3-[(3-oxocyclohexen-1-yl)amino]-1H-benzo[f]chromene-2-carbonitrile (PubChem CID 139218106) has the molecular formula C26H19ClN2O2 and a molecular weight of 426.90 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[(3-oxocyclohexen-1-yl)amino]-1H-benzo[f]chromene-2-carbonitrile.
| Compound Name | 1-(2-chlorophenyl)-3-[(3-oxocyclohexen-1-yl)amino]-1H-benzo[f]chromene-2-carbonitrile |
|---|---|
| PubChem CID | 139218106 |
| Molecular Formula | C26H19ClN2O2 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[(3-oxocyclohexen-1-yl)amino]-1H-benzo[f]chromene-2-carbonitrile |
| SMILES | N#CC1=C(NC2=CC(=O)CCC2)Oc2ccc3ccccc3c2C1c1ccccc1Cl |
| InChI | InChI=1S/C26H19ClN2O2/c27-22-11-4-3-10-20(22)24-21(15-28)26(29-17-7-5-8-18(30)14-17)31-23-13-12-16-6-1-2-9-19(16)25(23)24/h1-4,6,9-14,24,29H,5,7-8H2 |
| InChIKey | SQOLZNRRHVXMCD-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |