C14H9ClN4O2S — CID 3400766
7-amino-5-(2-chlorophenyl)-4-oxo-2-sulfanylidene-1,5-dihydropyrano[2,3-d]pyrimidine-6-carbonitrile (PubChem CID 3400766) has the molecular formula C14H9ClN4O2S and a molecular weight of 332.77 g/mol. Its IUPAC name is 7-amino-5-(2-chlorophenyl)-4-oxo-2-sulfanylidene-1,5-dihydropyrano[2,3-d]pyrimidine-6-carbonitrile.
| Compound Name | 7-amino-5-(2-chlorophenyl)-4-oxo-2-sulfanylidene-1,5-dihydropyrano[2,3-d]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 3400766 |
| Molecular Formula | C14H9ClN4O2S |
| Molecular Weight | 332.77 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 7-amino-5-(2-chlorophenyl)-4-oxo-2-sulfanylidene-1,5-dihydropyrano[2,3-d]pyrimidine-6-carbonitrile |
| SMILES | N#CC1=C(N)Oc2[nH]c(=S)[nH]c(=O)c2C1c1ccccc1Cl |
| InChI | InChI=1S/C14H9ClN4O2S/c15-8-4-2-1-3-6(8)9-7(5-16)11(17)21-13-10(9)12(20)18-14(22)19-13/h1-4,9H,17H2,(H2,18,19,20,22) |
| InChIKey | DVPYNSDSJJYAKD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.77 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|