C14H8ClN5O4S — CID 8613579
(5S)-7-amino-5-(4-chloro-3-nitrophenyl)-4-oxo-2-sulfanylidene-1,5-dihydropyrano[2,3-d]pyrimidine-6-carbonitrile (PubChem CID 8613579) has the molecular formula C14H8ClN5O4S and a molecular weight of 377.77 g/mol. Its IUPAC name is (5S)-7-amino-5-(4-chloro-3-nitrophenyl)-4-oxo-2-sulfanylidene-1,5-dihydropyrano[2,3-d]pyrimidine-6-carbonitrile.
| Compound Name | (5S)-7-amino-5-(4-chloro-3-nitrophenyl)-4-oxo-2-sulfanylidene-1,5-dihydropyrano[2,3-d]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 8613579 |
| Molecular Formula | C14H8ClN5O4S |
| Molecular Weight | 377.77 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | (5S)-7-amino-5-(4-chloro-3-nitrophenyl)-4-oxo-2-sulfanylidene-1,5-dihydropyrano[2,3-d]pyrimidine-6-carbonitrile |
| SMILES | N#CC1=C(N)Oc2[nH]c(=S)[nH]c(=O)c2[C@H]1c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H8ClN5O4S/c15-7-2-1-5(3-8(7)20(22)23)9-6(4-16)11(17)24-13-10(9)12(21)18-14(25)19-13/h1-3,9H,17H2,(H2,18,19,21,25)/t9-/m0/s1 |
| InChIKey | LRDTVFYYPKSERZ-VIFPVBQESA-N |
| XLogP | 2.21 |
| TPSA | 150.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.77 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|