C16H10ClN3O5 — CID 122202223
2-amino-4-(4-chloro-3-nitrophenyl)-6-methyl-8-oxo-4H-pyrano[3,2-b]pyran-3-carbonitrile (PubChem CID 122202223) has the molecular formula C16H10ClN3O5 and a molecular weight of 359.73 g/mol. Its IUPAC name is 2-amino-4-(4-chloro-3-nitrophenyl)-6-methyl-8-oxo-4H-pyrano[3,2-b]pyran-3-carbonitrile.
| Compound Name | 2-amino-4-(4-chloro-3-nitrophenyl)-6-methyl-8-oxo-4H-pyrano[3,2-b]pyran-3-carbonitrile |
|---|---|
| PubChem CID | 122202223 |
| Molecular Formula | C16H10ClN3O5 |
| Molecular Weight | 359.73 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 2-amino-4-(4-chloro-3-nitrophenyl)-6-methyl-8-oxo-4H-pyrano[3,2-b]pyran-3-carbonitrile |
| SMILES | Cc1cc(=O)c2c(o1)C(c1ccc(Cl)c([N+](=O)[O-])c1)C(C#N)=C(N)O2 |
| InChI | InChI=1S/C16H10ClN3O5/c1-7-4-12(21)14-15(24-7)13(9(6-18)16(19)25-14)8-2-3-10(17)11(5-8)20(22)23/h2-5,13H,19H2,1H3 |
| InChIKey | BOYCQGPBJBXZSW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.73 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|