C13H9N5O5S — CID 42556721
(5S)-7-amino-5-(5-methyl-4-nitrothiophen-2-yl)-2,4-dioxo-1,5-dihydropyrano[2,3-d]pyrimidine-6-carbonitrile (PubChem CID 42556721) has the molecular formula C13H9N5O5S and a molecular weight of 347.31 g/mol. Its IUPAC name is (5S)-7-amino-5-(5-methyl-4-nitrothiophen-2-yl)-2,4-dioxo-1,5-dihydropyrano[2,3-d]pyrimidine-6-carbonitrile.
| Compound Name | (5S)-7-amino-5-(5-methyl-4-nitrothiophen-2-yl)-2,4-dioxo-1,5-dihydropyrano[2,3-d]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 42556721 |
| Molecular Formula | C13H9N5O5S |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | (5S)-7-amino-5-(5-methyl-4-nitrothiophen-2-yl)-2,4-dioxo-1,5-dihydropyrano[2,3-d]pyrimidine-6-carbonitrile |
| SMILES | Cc1sc([C@H]2C(C#N)=C(N)Oc3[nH]c(=O)[nH]c(=O)c32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H9N5O5S/c1-4-6(18(21)22)2-7(24-4)8-5(3-14)10(15)23-12-9(8)11(19)16-13(20)17-12/h2,8H,15H2,1H3,(H2,16,17,19,20)/t8-/m1/s1 |
| InChIKey | CXJVDCUWPNQJKI-MRVPVSSYSA-N |
| XLogP | 0.56 |
| TPSA | 167.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|