C20H11ClN2O3 — CID 28611974
(4S)-2-amino-4-(2-chlorophenyl)-5,10-dioxo-4H-benzo[g]chromene-3-carbonitrile (PubChem CID 28611974) has the molecular formula C20H11ClN2O3 and a molecular weight of 362.77 g/mol. Its IUPAC name is (4S)-2-amino-4-(2-chlorophenyl)-5,10-dioxo-4H-benzo[g]chromene-3-carbonitrile.
| Compound Name | (4S)-2-amino-4-(2-chlorophenyl)-5,10-dioxo-4H-benzo[g]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 28611974 |
| Molecular Formula | C20H11ClN2O3 |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | (4S)-2-amino-4-(2-chlorophenyl)-5,10-dioxo-4H-benzo[g]chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)OC2=C(C(=O)c3ccccc3C2=O)[C@H]1c1ccccc1Cl |
| InChI | InChI=1S/C20H11ClN2O3/c21-14-8-4-3-7-12(14)15-13(9-22)20(23)26-19-16(15)17(24)10-5-1-2-6-11(10)18(19)25/h1-8,15H,23H2/t15-/m0/s1 |
| InChIKey | MOWADGKXXSOXSS-HNNXBMFYSA-N |
| XLogP | 3.48 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|