C26H16N2O4 — CID 25249030
2-amino-5,10-dioxo-4-(3-phenoxyphenyl)-4H-benzo[g]chromene-3-carbonitrile (PubChem CID 25249030) has the molecular formula C26H16N2O4 and a molecular weight of 420.42 g/mol. Its IUPAC name is 2-amino-5,10-dioxo-4-(3-phenoxyphenyl)-4H-benzo[g]chromene-3-carbonitrile.
| Compound Name | 2-amino-5,10-dioxo-4-(3-phenoxyphenyl)-4H-benzo[g]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 25249030 |
| Molecular Formula | C26H16N2O4 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 2-amino-5,10-dioxo-4-(3-phenoxyphenyl)-4H-benzo[g]chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)OC2=C(C(=O)c3ccccc3C2=O)C1c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C26H16N2O4/c27-14-20-21(15-7-6-10-17(13-15)31-16-8-2-1-3-9-16)22-23(29)18-11-4-5-12-19(18)24(30)25(22)32-26(20)28/h1-13,21H,28H2 |
| InChIKey | TXKLLCSBLYHZJZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 102.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|