C21H14N2O3 — CID 92652790
(4R)-2-amino-4-(4-methylphenyl)-5,10-dioxo-4H-benzo[g]chromene-3-carbonitrile (PubChem CID 92652790) has the molecular formula C21H14N2O3 and a molecular weight of 342.35 g/mol. Its IUPAC name is (4R)-2-amino-4-(4-methylphenyl)-5,10-dioxo-4H-benzo[g]chromene-3-carbonitrile.
| Compound Name | (4R)-2-amino-4-(4-methylphenyl)-5,10-dioxo-4H-benzo[g]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 92652790 |
| Molecular Formula | C21H14N2O3 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | (4R)-2-amino-4-(4-methylphenyl)-5,10-dioxo-4H-benzo[g]chromene-3-carbonitrile |
| SMILES | Cc1ccc([C@@H]2C(C#N)=C(N)OC3=C2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C21H14N2O3/c1-11-6-8-12(9-7-11)16-15(10-22)21(23)26-20-17(16)18(24)13-4-2-3-5-14(13)19(20)25/h2-9,16H,23H2,1H3/t16-/m1/s1 |
| InChIKey | CLYFIKGBPQXGNN-MRXNPFEDSA-N |
| XLogP | 3.14 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|