C20H12N2O4 — CID 7353433
(4S)-2-amino-4-(4-hydroxyphenyl)-5,10-dioxo-4H-benzo[g]chromene-3-carbonitrile (PubChem CID 7353433) has the molecular formula C20H12N2O4 and a molecular weight of 344.33 g/mol. Its IUPAC name is (4S)-2-amino-4-(4-hydroxyphenyl)-5,10-dioxo-4H-benzo[g]chromene-3-carbonitrile.
| Compound Name | (4S)-2-amino-4-(4-hydroxyphenyl)-5,10-dioxo-4H-benzo[g]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 7353433 |
| Molecular Formula | C20H12N2O4 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | (4S)-2-amino-4-(4-hydroxyphenyl)-5,10-dioxo-4H-benzo[g]chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)OC2=C(C(=O)c3ccccc3C2=O)[C@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C20H12N2O4/c21-9-14-15(10-5-7-11(23)8-6-10)16-17(24)12-3-1-2-4-13(12)18(25)19(16)26-20(14)22/h1-8,15,23H,22H2/t15-/m0/s1 |
| InChIKey | ZDKYVWRNATURHG-HNNXBMFYSA-N |
| XLogP | 2.53 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|