C15H10N2O3 — CID 51603575
(4R)-2-amino-4-methyl-5,10-dioxo-4H-benzo[g]chromene-3-carbonitrile (PubChem CID 51603575) has the molecular formula C15H10N2O3 and a molecular weight of 266.26 g/mol. Its IUPAC name is (4R)-2-amino-4-methyl-5,10-dioxo-4H-benzo[g]chromene-3-carbonitrile.
| Compound Name | (4R)-2-amino-4-methyl-5,10-dioxo-4H-benzo[g]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 51603575 |
| Molecular Formula | C15H10N2O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | (4R)-2-amino-4-methyl-5,10-dioxo-4H-benzo[g]chromene-3-carbonitrile |
| SMILES | C[C@@H]1C(C#N)=C(N)OC2=C1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C15H10N2O3/c1-7-10(6-16)15(17)20-14-11(7)12(18)8-4-2-3-5-9(8)13(14)19/h2-5,7H,17H2,1H3/t7-/m1/s1 |
| InChIKey | JMUIWFZUCPJXKV-SSDOTTSWSA-N |
| XLogP | 1.68 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|