C24H16ClN3O — CID 996629
(1R)-3-amino-1-(2-chloro-7-methylquinolin-3-yl)-1H-benzo[f]chromene-2-carbonitrile (PubChem CID 996629) has the molecular formula C24H16ClN3O and a molecular weight of 397.87 g/mol. Its IUPAC name is (1R)-3-amino-1-(2-chloro-7-methylquinolin-3-yl)-1H-benzo[f]chromene-2-carbonitrile.
| Compound Name | (1R)-3-amino-1-(2-chloro-7-methylquinolin-3-yl)-1H-benzo[f]chromene-2-carbonitrile |
|---|---|
| PubChem CID | 996629 |
| Molecular Formula | C24H16ClN3O |
| Molecular Weight | 397.87 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | (1R)-3-amino-1-(2-chloro-7-methylquinolin-3-yl)-1H-benzo[f]chromene-2-carbonitrile |
| SMILES | Cc1ccc2cc([C@H]3C(C#N)=C(N)Oc4ccc5ccccc5c43)c(Cl)nc2c1 |
| InChI | InChI=1S/C24H16ClN3O/c1-13-6-7-15-11-17(23(25)28-19(15)10-13)21-18(12-26)24(27)29-20-9-8-14-4-2-3-5-16(14)22(20)21/h2-11,21H,27H2,1H3/t21-/m0/s1 |
| InChIKey | DPXAKSOEZFMVBP-NRFANRHFSA-N |
| XLogP | 5.57 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.87 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|