C24H16ClN3O2 — CID 1130171
(4S)-2-amino-4-(2-chloro-6-methoxyquinolin-3-yl)-4H-benzo[h]chromene-3-carbonitrile (PubChem CID 1130171) has the molecular formula C24H16ClN3O2 and a molecular weight of 413.86 g/mol. Its IUPAC name is (4S)-2-amino-4-(2-chloro-6-methoxyquinolin-3-yl)-4H-benzo[h]chromene-3-carbonitrile.
| Compound Name | (4S)-2-amino-4-(2-chloro-6-methoxyquinolin-3-yl)-4H-benzo[h]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 1130171 |
| Molecular Formula | C24H16ClN3O2 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | (4S)-2-amino-4-(2-chloro-6-methoxyquinolin-3-yl)-4H-benzo[h]chromene-3-carbonitrile |
| SMILES | COc1ccc2nc(Cl)c([C@@H]3C(C#N)=C(N)Oc4c3ccc3ccccc43)cc2c1 |
| InChI | InChI=1S/C24H16ClN3O2/c1-29-15-7-9-20-14(10-15)11-18(23(25)28-20)21-17-8-6-13-4-2-3-5-16(13)22(17)30-24(27)19(21)12-26/h2-11,21H,27H2,1H3/t21-/m1/s1 |
| InChIKey | XLVOXOANUZTNIZ-OAQYLSRUSA-N |
| XLogP | 5.27 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|