C22H14ClN5O3 — CID 71519394
3-amino-1-(2-chloro-6-methoxyquinolin-3-yl)-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carbonitrile (PubChem CID 71519394) has the molecular formula C22H14ClN5O3 and a molecular weight of 431.84 g/mol. Its IUPAC name is 3-amino-1-(2-chloro-6-methoxyquinolin-3-yl)-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carbonitrile.
| Compound Name | 3-amino-1-(2-chloro-6-methoxyquinolin-3-yl)-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carbonitrile |
|---|---|
| PubChem CID | 71519394 |
| Molecular Formula | C22H14ClN5O3 |
| Molecular Weight | 431.84 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 3-amino-1-(2-chloro-6-methoxyquinolin-3-yl)-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carbonitrile |
| SMILES | COc1ccc2nc(Cl)c(C3C(C#N)=C(N)n4c(=O)c5ccccc5c(=O)n43)cc2c1 |
| InChI | InChI=1S/C22H14ClN5O3/c1-31-12-6-7-17-11(8-12)9-15(19(23)26-17)18-16(10-24)20(25)28-22(30)14-5-3-2-4-13(14)21(29)27(18)28/h2-9,18H,25H2,1H3 |
| InChIKey | RDQJDCDXWSBVNZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 115.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.84 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|