About 1-(2-chloro-6-methoxyquinolin-3-yl)-N-methylmethanimine;hydrate
1-(2-chloro-6-methoxyquinolin-3-yl)-N-methylmethanimine;hydrate (PubChem CID 166706707) has the molecular formula C12H13ClN2O2
and a molecular weight of 252.70 g/mol. Its IUPAC name is 1-(2-chloro-6-methoxyquinolin-3-yl)-N-methylmethanimine;hydrate.
Molecular Properties
| Compound Name | 1-(2-chloro-6-methoxyquinolin-3-yl)-N-methylmethanimine;hydrate |
| PubChem CID | 166706707 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 1-(2-chloro-6-methoxyquinolin-3-yl)-N-methylmethanimine;hydrate |
| SMILES | C/N=C/c1cc2cc(OC)ccc2nc1Cl.O |
| InChI | InChI=1S/C12H11ClN2O.H2O/c1-14-7-9-5-8-6-10(16-2)3-4-11(8)15-12(9)13;/h3-7H,1-2H3;1H2/b14-7+; |
| InChIKey | OTGHCRBTERPTAS-FJUODKGNSA-N |
| XLogP | 2.12 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-chloro-6-methoxyquinolin-3-yl)-N-methylmethanimine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloro-6-methoxyquinolin-3-yl)-N-methylmethanimine;hydrate?
The IUPAC name of 1-(2-chloro-6-methoxyquinolin-3-yl)-N-methylmethanimine;hydrate (CID 166706707) is 1-(2-chloro-6-methoxyquinolin-3-yl)-N-methylmethanimine;hydrate.
What is the SMILES notation for 1-(2-chloro-6-methoxyquinolin-3-yl)-N-methylmethanimine;hydrate?
The canonical SMILES for 1-(2-chloro-6-methoxyquinolin-3-yl)-N-methylmethanimine;hydrate is C/N=C/c1cc2cc(OC)ccc2nc1Cl.O.
What is the InChIKey of 1-(2-chloro-6-methoxyquinolin-3-yl)-N-methylmethanimine;hydrate?
The InChIKey is OTGHCRBTERPTAS-FJUODKGNSA-N. The full InChI is InChI=1S/C12H11ClN2O.H2O/c1-14-7-9-5-8-6-10(16-2)3-4-11(8)15-12(9)13;/h3-7H,1-2H3;1H2/b14-7+;.
What are the key properties of 1-(2-chloro-6-methoxyquinolin-3-yl)-N-methylmethanimine;hydrate?
1-(2-chloro-6-methoxyquinolin-3-yl)-N-methylmethanimine;hydrate has a molecular weight of 252.70 g/mol, XLogP of 2.12, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloro-6-methoxyquinolin-3-yl)-N-methylmethanimine;hydrate is sourced from PubChem (CID 166706707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).