C18H22ClN3O — CID 9012708
(Z)-1-(2-chloro-6-methoxyquinolin-3-yl)-N-[(2S,6S)-2,6-dimethylpiperidin-1-yl]methanimine (PubChem CID 9012708) has the molecular formula C18H22ClN3O and a molecular weight of 331.85 g/mol. Its IUPAC name is (Z)-1-(2-chloro-6-methoxyquinolin-3-yl)-N-[(2S,6S)-2,6-dimethylpiperidin-1-yl]methanimine.
| Compound Name | (Z)-1-(2-chloro-6-methoxyquinolin-3-yl)-N-[(2S,6S)-2,6-dimethylpiperidin-1-yl]methanimine |
|---|---|
| PubChem CID | 9012708 |
| Molecular Formula | C18H22ClN3O |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | (Z)-1-(2-chloro-6-methoxyquinolin-3-yl)-N-[(2S,6S)-2,6-dimethylpiperidin-1-yl]methanimine |
| SMILES | COc1ccc2nc(Cl)c(/C=N\N3[C@@H](C)CCC[C@@H]3C)cc2c1 |
| InChI | InChI=1S/C18H22ClN3O/c1-12-5-4-6-13(2)22(12)20-11-15-9-14-10-16(23-3)7-8-17(14)21-18(15)19/h7-13H,4-6H2,1-3H3/b20-11-/t12-,13-/m0/s1 |
| InChIKey | UUOIMCGVODWJNT-VCOXBAQVSA-N |
| XLogP | 4.49 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|