C17H26N2O3 — CID 9012658
(Z)-N-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-1-(2,4,6-trimethoxyphenyl)methanimine (PubChem CID 9012658) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is (Z)-N-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-1-(2,4,6-trimethoxyphenyl)methanimine.
| Compound Name | (Z)-N-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-1-(2,4,6-trimethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 9012658 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | (Z)-N-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-1-(2,4,6-trimethoxyphenyl)methanimine |
| SMILES | COc1cc(OC)c(/C=N\N2[C@@H](C)CCC[C@@H]2C)c(OC)c1 |
| InChI | InChI=1S/C17H26N2O3/c1-12-7-6-8-13(2)19(12)18-11-15-16(21-4)9-14(20-3)10-17(15)22-5/h9-13H,6-8H2,1-5H3/b18-11-/t12-,13-/m0/s1 |
| InChIKey | RCVPAWGZRIGIQG-PWONOCEESA-N |
| XLogP | 3.31 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|