C16H23N3O4 — CID 9012469
(Z)-1-(4,5-dimethoxy-2-nitrophenyl)-N-[(2R,6R)-2,6-dimethylpiperidin-1-yl]methanimine (PubChem CID 9012469) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is (Z)-1-(4,5-dimethoxy-2-nitrophenyl)-N-[(2R,6R)-2,6-dimethylpiperidin-1-yl]methanimine.
| Compound Name | (Z)-1-(4,5-dimethoxy-2-nitrophenyl)-N-[(2R,6R)-2,6-dimethylpiperidin-1-yl]methanimine |
|---|---|
| PubChem CID | 9012469 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (Z)-1-(4,5-dimethoxy-2-nitrophenyl)-N-[(2R,6R)-2,6-dimethylpiperidin-1-yl]methanimine |
| SMILES | COc1cc(/C=N\N2[C@H](C)CCC[C@H]2C)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C16H23N3O4/c1-11-6-5-7-12(2)18(11)17-10-13-8-15(22-3)16(23-4)9-14(13)19(20)21/h8-12H,5-7H2,1-4H3/b17-10-/t11-,12-/m1/s1 |
| InChIKey | NNEOEDJKTQUJSJ-RISRJPFHSA-N |
| XLogP | 3.21 |
| TPSA | 77.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|