C17H24N2O3 — CID 9012463
[4-[(Z)-[(2S,6S)-2,6-dimethylpiperidin-1-yl]iminomethyl]-2-methoxyphenyl] acetate (PubChem CID 9012463) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is [4-[(Z)-[(2S,6S)-2,6-dimethylpiperidin-1-yl]iminomethyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(Z)-[(2S,6S)-2,6-dimethylpiperidin-1-yl]iminomethyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 9012463 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | [4-[(Z)-[(2S,6S)-2,6-dimethylpiperidin-1-yl]iminomethyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(/C=N\N2[C@@H](C)CCC[C@@H]2C)ccc1OC(C)=O |
| InChI | InChI=1S/C17H24N2O3/c1-12-6-5-7-13(2)19(12)18-11-15-8-9-16(22-14(3)20)17(10-15)21-4/h8-13H,5-7H2,1-4H3/b18-11-/t12-,13-/m0/s1 |
| InChIKey | CLHNFOIPWGXYPT-PWONOCEESA-N |
| XLogP | 3.22 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|