C22H16N2O5 — CID 8979943
[4-[(Z)-(1,3-dioxobenzo[de]isoquinolin-2-yl)iminomethyl]-2-methoxyphenyl] acetate (PubChem CID 8979943) has the molecular formula C22H16N2O5 and a molecular weight of 388.38 g/mol. Its IUPAC name is [4-[(Z)-(1,3-dioxobenzo[de]isoquinolin-2-yl)iminomethyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(Z)-(1,3-dioxobenzo[de]isoquinolin-2-yl)iminomethyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 8979943 |
| Molecular Formula | C22H16N2O5 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | [4-[(Z)-(1,3-dioxobenzo[de]isoquinolin-2-yl)iminomethyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(/C=N\N2C(=O)c3cccc4cccc(c34)C2=O)ccc1OC(C)=O |
| InChI | InChI=1S/C22H16N2O5/c1-13(25)29-18-10-9-14(11-19(18)28-2)12-23-24-21(26)16-7-3-5-15-6-4-8-17(20(15)16)22(24)27/h3-12H,1-2H3/b23-12- |
| InChIKey | QECKLKRVOHQJLX-FMCGGJTJSA-N |
| XLogP | 3.40 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|