C22H18N2O5 — CID 9359802
2-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]benzo[de]isoquinoline-1,3-dione (PubChem CID 9359802) has the molecular formula C22H18N2O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is 2-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 9359802 |
| Molecular Formula | C22H18N2O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]benzo[de]isoquinoline-1,3-dione |
| SMILES | COc1ccc(/C=N\N2C(=O)c3cccc4cccc(c34)C2=O)c(OC)c1OC |
| InChI | InChI=1S/C22H18N2O5/c1-27-17-11-10-14(19(28-2)20(17)29-3)12-23-24-21(25)15-8-4-6-13-7-5-9-16(18(13)15)22(24)26/h4-12H,1-3H3/b23-12- |
| InChIKey | NWEFDORBYOMFBM-FMCGGJTJSA-N |
| XLogP | 3.50 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|