C16H11FN2O3 — CID 8973003
2-[(Z)-(3-fluoro-4-methoxyphenyl)methylideneamino]isoindole-1,3-dione (PubChem CID 8973003) has the molecular formula C16H11FN2O3 and a molecular weight of 298.27 g/mol. Its IUPAC name is 2-[(Z)-(3-fluoro-4-methoxyphenyl)methylideneamino]isoindole-1,3-dione.
| Compound Name | 2-[(Z)-(3-fluoro-4-methoxyphenyl)methylideneamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 8973003 |
| Molecular Formula | C16H11FN2O3 |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2-[(Z)-(3-fluoro-4-methoxyphenyl)methylideneamino]isoindole-1,3-dione |
| SMILES | COc1ccc(/C=N\N2C(=O)c3ccccc3C2=O)cc1F |
| InChI | InChI=1S/C16H11FN2O3/c1-22-14-7-6-10(8-13(14)17)9-18-19-15(20)11-4-2-3-5-12(11)16(19)21/h2-9H,1H3/b18-9- |
| InChIKey | KAXUEJCAOFAHIF-NVMNQCDNSA-N |
| XLogP | 2.46 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|