C20H16N2O5 — CID 9072432
[4-[(Z)-(1,3-dioxoisoindol-2-yl)iminomethyl]-2-methoxyphenyl] cyclopropanecarboxylate (PubChem CID 9072432) has the molecular formula C20H16N2O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is [4-[(Z)-(1,3-dioxoisoindol-2-yl)iminomethyl]-2-methoxyphenyl] cyclopropanecarboxylate.
| Compound Name | [4-[(Z)-(1,3-dioxoisoindol-2-yl)iminomethyl]-2-methoxyphenyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 9072432 |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | [4-[(Z)-(1,3-dioxoisoindol-2-yl)iminomethyl]-2-methoxyphenyl] cyclopropanecarboxylate |
| SMILES | COc1cc(/C=N\N2C(=O)c3ccccc3C2=O)ccc1OC(=O)C1CC1 |
| InChI | InChI=1S/C20H16N2O5/c1-26-17-10-12(6-9-16(17)27-20(25)13-7-8-13)11-21-22-18(23)14-4-2-3-5-15(14)19(22)24/h2-6,9-11,13H,7-8H2,1H3/b21-11- |
| InChIKey | ODRWOEPEVUWKFF-NHDPSOOVSA-N |
| XLogP | 2.64 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|