C24H14N4O4 — CID 1098364
2-[[4-[(1,3-dioxoisoindol-2-yl)iminomethyl]phenyl]methylideneamino]isoindole-1,3-dione (PubChem CID 1098364) has the molecular formula C24H14N4O4 and a molecular weight of 422.40 g/mol. Its IUPAC name is 2-[[4-[(1,3-dioxoisoindol-2-yl)iminomethyl]phenyl]methylideneamino]isoindole-1,3-dione.
| Compound Name | 2-[[4-[(1,3-dioxoisoindol-2-yl)iminomethyl]phenyl]methylideneamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 1098364 |
| Molecular Formula | C24H14N4O4 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 2-[[4-[(1,3-dioxoisoindol-2-yl)iminomethyl]phenyl]methylideneamino]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1N=Cc1ccc(C=NN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C24H14N4O4/c29-21-17-5-1-2-6-18(17)22(30)27(21)25-13-15-9-11-16(12-10-15)14-26-28-23(31)19-7-3-4-8-20(19)24(28)32/h1-14H |
| InChIKey | VFLPACFXJWHMTP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 99.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|