C21H14N2O2 — CID 6909855
2-[(E)-(4-phenylphenyl)methylideneamino]isoindole-1,3-dione (PubChem CID 6909855) has the molecular formula C21H14N2O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is 2-[(E)-(4-phenylphenyl)methylideneamino]isoindole-1,3-dione.
| Compound Name | 2-[(E)-(4-phenylphenyl)methylideneamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6909855 |
| Molecular Formula | C21H14N2O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 2-[(E)-(4-phenylphenyl)methylideneamino]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1/N=C/c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H14N2O2/c24-20-18-8-4-5-9-19(18)21(25)23(20)22-14-15-10-12-17(13-11-15)16-6-2-1-3-7-16/h1-14H/b22-14+ |
| InChIKey | ROGJYQQYCMEEOI-HYARGMPZSA-N |
| XLogP | 3.98 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|