C14H9N3O2 — CID 901062
2-(pyridin-2-ylmethylideneamino)isoindole-1,3-dione (PubChem CID 901062) has the molecular formula C14H9N3O2 and a molecular weight of 251.25 g/mol. Its IUPAC name is 2-(pyridin-2-ylmethylideneamino)isoindole-1,3-dione.
| Compound Name | 2-(pyridin-2-ylmethylideneamino)isoindole-1,3-dione |
|---|---|
| PubChem CID | 901062 |
| Molecular Formula | C14H9N3O2 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-(pyridin-2-ylmethylideneamino)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1N=Cc1ccccn1 |
| InChI | InChI=1S/C14H9N3O2/c18-13-11-6-1-2-7-12(11)14(19)17(13)16-9-10-5-3-4-8-15-10/h1-9H |
| InChIKey | QYPZLFYRCFTZES-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 62.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|