C17H14N2O3 — CID 5332496
2-[(E)-(4-ethoxyphenyl)methylideneamino]isoindole-1,3-dione (PubChem CID 5332496) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-[(E)-(4-ethoxyphenyl)methylideneamino]isoindole-1,3-dione.
| Compound Name | 2-[(E)-(4-ethoxyphenyl)methylideneamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 5332496 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-[(E)-(4-ethoxyphenyl)methylideneamino]isoindole-1,3-dione |
| SMILES | CCOc1ccc(/C=N/N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C17H14N2O3/c1-2-22-13-9-7-12(8-10-13)11-18-19-16(20)14-5-3-4-6-15(14)17(19)21/h3-11H,2H2,1H3/b18-11+ |
| InChIKey | YWFALNDSTQGAOF-WOJGMQOQSA-N |
| XLogP | 2.72 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|