C18H16N2O4 — CID 135852605
2-[(E)-(2-hydroxy-4-propoxyphenyl)methylideneamino]isoindole-1,3-dione (PubChem CID 135852605) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is 2-[(E)-(2-hydroxy-4-propoxyphenyl)methylideneamino]isoindole-1,3-dione.
| Compound Name | 2-[(E)-(2-hydroxy-4-propoxyphenyl)methylideneamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 135852605 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 2-[(E)-(2-hydroxy-4-propoxyphenyl)methylideneamino]isoindole-1,3-dione |
| SMILES | CCCOc1ccc(/C=N/N2C(=O)c3ccccc3C2=O)c(O)c1 |
| InChI | InChI=1S/C18H16N2O4/c1-2-9-24-13-8-7-12(16(21)10-13)11-19-20-17(22)14-5-3-4-6-15(14)18(20)23/h3-8,10-11,21H,2,9H2,1H3/b19-11+ |
| InChIKey | DGSSJBYQPYTIOX-YBFXNURJSA-N |
| XLogP | 2.81 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|