C20H21N3O4 — CID 135673713
(5R)-3-[(E)-(2-hydroxy-4-propoxyphenyl)methylideneamino]-5-methyl-5-phenylimidazolidine-2,4-dione (PubChem CID 135673713) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is (5R)-3-[(E)-(2-hydroxy-4-propoxyphenyl)methylideneamino]-5-methyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(E)-(2-hydroxy-4-propoxyphenyl)methylideneamino]-5-methyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 135673713 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | (5R)-3-[(E)-(2-hydroxy-4-propoxyphenyl)methylideneamino]-5-methyl-5-phenylimidazolidine-2,4-dione |
| SMILES | CCCOc1ccc(/C=N/N2C(=O)N[C@](C)(c3ccccc3)C2=O)c(O)c1 |
| InChI | InChI=1S/C20H21N3O4/c1-3-11-27-16-10-9-14(17(24)12-16)13-21-23-18(25)20(2,22-19(23)26)15-7-5-4-6-8-15/h4-10,12-13,24H,3,11H2,1-2H3,(H,22,26)/b21-13+/t20-/m1/s1 |
| InChIKey | PDLSBVYBDKIXGG-TTYLXTBDSA-N |
| XLogP | 2.98 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|