C21H24N4O2 — CID 9260846
(5R)-3-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-5-methyl-5-phenylimidazolidine-2,4-dione (PubChem CID 9260846) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is (5R)-3-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-5-methyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-5-methyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9260846 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (5R)-3-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-5-methyl-5-phenylimidazolidine-2,4-dione |
| SMILES | CCN(CC)c1ccc(/C=N\N2C(=O)N[C@](C)(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C21H24N4O2/c1-4-24(5-2)18-13-11-16(12-14-18)15-22-25-19(26)21(3,23-20(25)27)17-9-7-6-8-10-17/h6-15H,4-5H2,1-3H3,(H,23,27)/b22-15-/t21-/m1/s1 |
| InChIKey | GPJOCSFMNRVJHC-JHRFGPFWSA-N |
| XLogP | 3.33 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|